C15H14BrF3N2O3 — CID 129144445
4-[[2-[amino(methyl)amino]-6-(trifluoromethoxy)phenyl]methoxy]-3-bromophenol (PubChem CID 129144445) has the molecular formula C15H14BrF3N2O3 and a molecular weight of 407.19 g/mol. Its IUPAC name is 4-[[2-[amino(methyl)amino]-6-(trifluoromethoxy)phenyl]methoxy]-3-bromophenol.
| Compound Name | 4-[[2-[amino(methyl)amino]-6-(trifluoromethoxy)phenyl]methoxy]-3-bromophenol |
|---|---|
| PubChem CID | 129144445 |
| Molecular Formula | C15H14BrF3N2O3 |
| Molecular Weight | 407.19 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 4-[[2-[amino(methyl)amino]-6-(trifluoromethoxy)phenyl]methoxy]-3-bromophenol |
| SMILES | CN(N)c1cccc(OC(F)(F)F)c1COc1ccc(O)cc1Br |
| InChI | InChI=1S/C15H14BrF3N2O3/c1-21(20)12-3-2-4-13(24-15(17,18)19)10(12)8-23-14-6-5-9(22)7-11(14)16/h2-7,22H,8,20H2,1H3 |
| InChIKey | IXFQCSVHEWSICU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.19 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|