C20H21ClN6O2 — CID 146631760
1,3-diamino-1-[2-[[2-(2-chlorophenyl)pyrimidin-4-yl]oxymethyl]-3-methylphenyl]-3-methylurea (PubChem CID 146631760) has the molecular formula C20H21ClN6O2 and a molecular weight of 412.88 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[[2-(2-chlorophenyl)pyrimidin-4-yl]oxymethyl]-3-methylphenyl]-3-methylurea.
| Compound Name | 1,3-diamino-1-[2-[[2-(2-chlorophenyl)pyrimidin-4-yl]oxymethyl]-3-methylphenyl]-3-methylurea |
|---|---|
| PubChem CID | 146631760 |
| Molecular Formula | C20H21ClN6O2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 1,3-diamino-1-[2-[[2-(2-chlorophenyl)pyrimidin-4-yl]oxymethyl]-3-methylphenyl]-3-methylurea |
| SMILES | Cc1cccc(N(N)C(=O)N(C)N)c1COc1ccnc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C20H21ClN6O2/c1-13-6-5-9-17(27(23)20(28)26(2)22)15(13)12-29-18-10-11-24-19(25-18)14-7-3-4-8-16(14)21/h3-11H,12,22-23H2,1-2H3 |
| InChIKey | QITVTYODMLMGKY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|