C15H18ClN5O3 — CID 134547881
1,3-diamino-1-[3-chloro-2-[(6-methoxy-2-pyridinyl)oxymethyl]phenyl]-3-methylurea (PubChem CID 134547881) has the molecular formula C15H18ClN5O3 and a molecular weight of 351.79 g/mol. Its IUPAC name is 1,3-diamino-1-[3-chloro-2-[(6-methoxy-2-pyridinyl)oxymethyl]phenyl]-3-methylurea.
| Compound Name | 1,3-diamino-1-[3-chloro-2-[(6-methoxy-2-pyridinyl)oxymethyl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 134547881 |
| Molecular Formula | C15H18ClN5O3 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 1,3-diamino-1-[3-chloro-2-[(6-methoxy-2-pyridinyl)oxymethyl]phenyl]-3-methylurea |
| SMILES | COc1cccc(OCc2c(Cl)cccc2N(N)C(=O)N(C)N)n1 |
| InChI | InChI=1S/C15H18ClN5O3/c1-20(17)15(22)21(18)12-6-3-5-11(16)10(12)9-24-14-8-4-7-13(19-14)23-2/h3-8H,9,17-18H2,1-2H3 |
| InChIKey | NIEFCWSUNRMMBB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|