C19H22ClN7O4 — CID 138495683
1,3-diamino-1-[3-chloro-2-[[1-(2,6-dimethoxy-3-pyridinyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methylurea (PubChem CID 138495683) has the molecular formula C19H22ClN7O4 and a molecular weight of 447.88 g/mol. Its IUPAC name is 1,3-diamino-1-[3-chloro-2-[[1-(2,6-dimethoxy-3-pyridinyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methylurea.
| Compound Name | 1,3-diamino-1-[3-chloro-2-[[1-(2,6-dimethoxy-3-pyridinyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 138495683 |
| Molecular Formula | C19H22ClN7O4 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 1,3-diamino-1-[3-chloro-2-[[1-(2,6-dimethoxy-3-pyridinyl)pyrazol-3-yl]oxymethyl]phenyl]-3-methylurea |
| SMILES | COc1ccc(-n2ccc(OCc3c(Cl)cccc3N(N)C(=O)N(C)N)n2)c(OC)n1 |
| InChI | InChI=1S/C19H22ClN7O4/c1-25(21)19(28)27(22)14-6-4-5-13(20)12(14)11-31-17-9-10-26(24-17)15-7-8-16(29-2)23-18(15)30-3/h4-10H,11,21-22H2,1-3H3 |
| InChIKey | XEHAWUPPTDVKPP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|