C20H24BrClN6O2 — CID 145093650
[2-[amino-[amino(methyl)carbamoyl]amino]-6-chlorophenyl]methyl (NE,1E)-N-[1-(3-bromophenyl)ethylidene]propanehydrazonate (PubChem CID 145093650) has the molecular formula C20H24BrClN6O2 and a molecular weight of 495.81 g/mol. Its IUPAC name is [2-[amino-[amino(methyl)carbamoyl]amino]-6-chlorophenyl]methyl (NE,1E)-N-[1-(3-bromophenyl)ethylidene]propanehydrazonate.
| Compound Name | [2-[amino-[amino(methyl)carbamoyl]amino]-6-chlorophenyl]methyl (NE,1E)-N-[1-(3-bromophenyl)ethylidene]propanehydrazonate |
|---|---|
| PubChem CID | 145093650 |
| Molecular Formula | C20H24BrClN6O2 |
| Molecular Weight | 495.81 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | [2-[amino-[amino(methyl)carbamoyl]amino]-6-chlorophenyl]methyl (NE,1E)-N-[1-(3-bromophenyl)ethylidene]propanehydrazonate |
| SMILES | CC/C(=N\N=C(/C)c1cccc(Br)c1)OCc1c(Cl)cccc1N(N)C(=O)N(C)N |
| InChI | InChI=1S/C20H24BrClN6O2/c1-4-19(26-25-13(2)14-7-5-8-15(21)11-14)30-12-16-17(22)9-6-10-18(16)28(24)20(29)27(3)23/h5-11H,4,12,23-24H2,1-3H3/b25-13+,26-19+ |
| InChIKey | AGBGHJWAHOGPPB-OXSKGNKOSA-N |
| XLogP | 4.46 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|