C18H26N6O — CID 134557294
[2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(1-methylpyrazol-3-yl)ethylidene]propanehydrazonate (PubChem CID 134557294) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is [2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(1-methylpyrazol-3-yl)ethylidene]propanehydrazonate.
| Compound Name | [2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(1-methylpyrazol-3-yl)ethylidene]propanehydrazonate |
|---|---|
| PubChem CID | 134557294 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [2-[amino(methyl)amino]-6-methylphenyl]methyl N-[1-(1-methylpyrazol-3-yl)ethylidene]propanehydrazonate |
| SMILES | CCC(=NN=C(C)c1ccn(C)n1)OCc1c(C)cccc1N(C)N |
| InChI | InChI=1S/C18H26N6O/c1-6-18(21-20-14(3)16-10-11-23(4)22-16)25-12-15-13(2)8-7-9-17(15)24(5)19/h7-11H,6,12,19H2,1-5H3 |
| InChIKey | VDBYSEAHQBEJOP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 81.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|