C18H22N8O2 — CID 153296920
[2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-[1-(1H-pyrazol-5-yl)ethylidene]propanehydrazonate (PubChem CID 153296920) has the molecular formula C18H22N8O2 and a molecular weight of 382.43 g/mol. Its IUPAC name is [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-[1-(1H-pyrazol-5-yl)ethylidene]propanehydrazonate.
| Compound Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-[1-(1H-pyrazol-5-yl)ethylidene]propanehydrazonate |
|---|---|
| PubChem CID | 153296920 |
| Molecular Formula | C18H22N8O2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-[1-(1H-pyrazol-5-yl)ethylidene]propanehydrazonate |
| SMILES | CCC(=NN=C(C)c1ccn[nH]1)OCc1c(C)cccc1-n1nnn(C)c1=O |
| InChI | InChI=1S/C18H22N8O2/c1-5-17(22-20-13(3)15-9-10-19-21-15)28-11-14-12(2)7-6-8-16(14)26-18(27)25(4)23-24-26/h6-10H,5,11H2,1-4H3,(H,19,21) |
| InChIKey | FGADKPVDPOKVIP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|