C21H24FN7O2 — CID 153296930
[2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N'-[1-(4-fluorophenyl)ethylideneamino]-N,N-dimethylcarbamimidate (PubChem CID 153296930) has the molecular formula C21H24FN7O2 and a molecular weight of 425.47 g/mol. Its IUPAC name is [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N'-[1-(4-fluorophenyl)ethylideneamino]-N,N-dimethylcarbamimidate.
| Compound Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N'-[1-(4-fluorophenyl)ethylideneamino]-N,N-dimethylcarbamimidate |
|---|---|
| PubChem CID | 153296930 |
| Molecular Formula | C21H24FN7O2 |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N'-[1-(4-fluorophenyl)ethylideneamino]-N,N-dimethylcarbamimidate |
| SMILES | CC(=NN=C(OCc1c(C)cccc1-n1nnn(C)c1=O)N(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FN7O2/c1-14-7-6-8-19(29-21(30)28(5)25-26-29)18(14)13-31-20(27(3)4)24-23-15(2)16-9-11-17(22)12-10-16/h6-12H,13H2,1-5H3 |
| InChIKey | KLJNJKHBIUOTKN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 89.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|