C25H31N7O3 — CID 142358758
[2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-[3-[(3-methylphenyl)methoxyimino]butan-2-ylidene]propanehydrazonate (PubChem CID 142358758) has the molecular formula C25H31N7O3 and a molecular weight of 477.57 g/mol. Its IUPAC name is [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-[3-[(3-methylphenyl)methoxyimino]butan-2-ylidene]propanehydrazonate.
| Compound Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-[3-[(3-methylphenyl)methoxyimino]butan-2-ylidene]propanehydrazonate |
|---|---|
| PubChem CID | 142358758 |
| Molecular Formula | C25H31N7O3 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-[3-[(3-methylphenyl)methoxyimino]butan-2-ylidene]propanehydrazonate |
| SMILES | CCC(=NN=C(C)C(C)=NOCc1cccc(C)c1)OCc1c(C)cccc1-n1nnn(C)c1=O |
| InChI | InChI=1S/C25H31N7O3/c1-7-24(27-26-19(4)20(5)28-35-15-21-12-8-10-17(2)14-21)34-16-22-18(3)11-9-13-23(22)32-25(33)31(6)29-30-32/h8-14H,7,15-16H2,1-6H3 |
| InChIKey | PCMNOZZVTNMNHB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 108.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|