C23H26N8O2 — CID 142358772
[2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-[1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethylidene]propanehydrazonate (PubChem CID 142358772) has the molecular formula C23H26N8O2 and a molecular weight of 446.52 g/mol. Its IUPAC name is [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-[1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethylidene]propanehydrazonate.
| Compound Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-[1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethylidene]propanehydrazonate |
|---|---|
| PubChem CID | 142358772 |
| Molecular Formula | C23H26N8O2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-[1-(1-methylpyrrolo[2,3-b]pyridin-3-yl)ethylidene]propanehydrazonate |
| SMILES | CCC(=NN=C(C)c1cn(C)c2ncccc12)OCc1c(C)cccc1-n1nnn(C)c1=O |
| InChI | InChI=1S/C23H26N8O2/c1-6-21(26-25-16(3)18-13-29(4)22-17(18)10-8-12-24-22)33-14-19-15(2)9-7-11-20(19)31-23(32)30(5)27-28-31/h7-13H,6,14H2,1-5H3 |
| InChIKey | OQZXKWOIUHKJPB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 104.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|