C19H26N8O2 — CID 134556970
[2-[amino-[amino(methyl)carbamoyl]amino]-6-methylphenyl]methyl N-(1-pyrazin-2-ylethylidene)propanehydrazonate (PubChem CID 134556970) has the molecular formula C19H26N8O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is [2-[amino-[amino(methyl)carbamoyl]amino]-6-methylphenyl]methyl N-(1-pyrazin-2-ylethylidene)propanehydrazonate.
| Compound Name | [2-[amino-[amino(methyl)carbamoyl]amino]-6-methylphenyl]methyl N-(1-pyrazin-2-ylethylidene)propanehydrazonate |
|---|---|
| PubChem CID | 134556970 |
| Molecular Formula | C19H26N8O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | [2-[amino-[amino(methyl)carbamoyl]amino]-6-methylphenyl]methyl N-(1-pyrazin-2-ylethylidene)propanehydrazonate |
| SMILES | CCC(=NN=C(C)c1cnccn1)OCc1c(C)cccc1N(N)C(=O)N(C)N |
| InChI | InChI=1S/C19H26N8O2/c1-5-18(25-24-14(3)16-11-22-9-10-23-16)29-12-15-13(2)7-6-8-17(15)27(21)19(28)26(4)20/h6-11H,5,12,20-21H2,1-4H3 |
| InChIKey | HULRURDQALNUDW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|