C26H37N5O2 — CID 142358707
N-amino-N-methylformamide;[2-methyl-6-(methylamino)phenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylidene]propanehydrazonate (PubChem CID 142358707) has the molecular formula C26H37N5O2 and a molecular weight of 451.62 g/mol. Its IUPAC name is N-amino-N-methylformamide;[2-methyl-6-(methylamino)phenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylidene]propanehydrazonate.
| Compound Name | N-amino-N-methylformamide;[2-methyl-6-(methylamino)phenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylidene]propanehydrazonate |
|---|---|
| PubChem CID | 142358707 |
| Molecular Formula | C26H37N5O2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | N-amino-N-methylformamide;[2-methyl-6-(methylamino)phenyl]methyl N-[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethylidene]propanehydrazonate |
| SMILES | CCC(=NN=C(C)c1cccc2c1CCCC2)OCc1c(C)cccc1NC.CN(N)C=O |
| InChI | InChI=1S/C24H31N3O.C2H6N2O/c1-5-24(28-16-22-17(2)10-8-15-23(22)25-4)27-26-18(3)20-14-9-12-19-11-6-7-13-21(19)20;1-4(3)2-5/h8-10,12,14-15,25H,5-7,11,13,16H2,1-4H3;2H,3H2,1H3 |
| InChIKey | XEUMYIRBZVHALU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|