C23H34N4O — CID 144635428
1-ethenyl-1-methylhydrazine;2-[[1-(3-ethyl-2-methylphenyl)ethylideneamino]oxymethyl]-N,3-dimethylaniline (PubChem CID 144635428) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-ethenyl-1-methylhydrazine;2-[[1-(3-ethyl-2-methylphenyl)ethylideneamino]oxymethyl]-N,3-dimethylaniline.
| Compound Name | 1-ethenyl-1-methylhydrazine;2-[[1-(3-ethyl-2-methylphenyl)ethylideneamino]oxymethyl]-N,3-dimethylaniline |
|---|---|
| PubChem CID | 144635428 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 1-ethenyl-1-methylhydrazine;2-[[1-(3-ethyl-2-methylphenyl)ethylideneamino]oxymethyl]-N,3-dimethylaniline |
| SMILES | C=CN(C)N.CCc1cccc(C(C)=NOCc2c(C)cccc2NC)c1C |
| InChI | InChI=1S/C20H26N2O.C3H8N2/c1-6-17-10-8-11-18(15(17)3)16(4)22-23-13-19-14(2)9-7-12-20(19)21-5;1-3-5(2)4/h7-12,21H,6,13H2,1-5H3;3H,1,4H2,2H3 |
| InChIKey | VVCXWIBBFAAPIO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|