C22H29F3N2O — CID 144635420
N,3-dimethyl-2-[[[(6E,8Z)-5-methyl-7-(trifluoromethyl)undeca-6,8,10-trien-4-ylidene]amino]oxymethyl]aniline (PubChem CID 144635420) has the molecular formula C22H29F3N2O and a molecular weight of 394.48 g/mol. Its IUPAC name is N,3-dimethyl-2-[[[(6E,8Z)-5-methyl-7-(trifluoromethyl)undeca-6,8,10-trien-4-ylidene]amino]oxymethyl]aniline.
| Compound Name | N,3-dimethyl-2-[[[(6E,8Z)-5-methyl-7-(trifluoromethyl)undeca-6,8,10-trien-4-ylidene]amino]oxymethyl]aniline |
|---|---|
| PubChem CID | 144635420 |
| Molecular Formula | C22H29F3N2O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | N,3-dimethyl-2-[[[(6E,8Z)-5-methyl-7-(trifluoromethyl)undeca-6,8,10-trien-4-ylidene]amino]oxymethyl]aniline |
| SMILES | C=C/C=C\C(=C/C(C)C(CCC)=NOCc1c(C)cccc1NC)C(F)(F)F |
| InChI | InChI=1S/C22H29F3N2O/c1-6-8-12-18(22(23,24)25)14-17(4)20(10-7-2)27-28-15-19-16(3)11-9-13-21(19)26-5/h6,8-9,11-14,17,26H,1,7,10,15H2,2-5H3/b12-8-,18-14+,27-20? |
| InChIKey | RPNNSEZLWGHLIN-RIOBGMPZSA-N |
| XLogP | 6.58 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|