C21H29N5O2 — CID 172985711
1-diazenyl-3-[2-[[(Z)-1-(5-ethyl-6-methylcyclohexa-1,5-dien-1-yl)ethylideneamino]oxymethyl]-3-methylphenyl]-1-methylurea (PubChem CID 172985711) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-diazenyl-3-[2-[[(Z)-1-(5-ethyl-6-methylcyclohexa-1,5-dien-1-yl)ethylideneamino]oxymethyl]-3-methylphenyl]-1-methylurea.
| Compound Name | 1-diazenyl-3-[2-[[(Z)-1-(5-ethyl-6-methylcyclohexa-1,5-dien-1-yl)ethylideneamino]oxymethyl]-3-methylphenyl]-1-methylurea |
|---|---|
| PubChem CID | 172985711 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 1-diazenyl-3-[2-[[(Z)-1-(5-ethyl-6-methylcyclohexa-1,5-dien-1-yl)ethylideneamino]oxymethyl]-3-methylphenyl]-1-methylurea |
| SMILES | [H]/N=N/N(C)C(=O)Nc1cccc(C)c1CO/N=C(/C)C1=CCCC(CC)=C1C |
| InChI | InChI=1S/C21H29N5O2/c1-6-17-10-8-11-18(15(17)3)16(4)24-28-13-19-14(2)9-7-12-20(19)23-21(27)26(5)25-22/h7,9,11-12,22H,6,8,10,13H2,1-5H3,(H,23,27)/b24-16-,25-22+ |
| InChIKey | URGFFFQGNDMEIR-FOUXXRDISA-N |
| XLogP | 5.74 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|