C10H11F3N4O — CID 163985169
1-diazenyl-1-methyl-3-[2-methyl-3-(trifluoromethyl)phenyl]urea (PubChem CID 163985169) has the molecular formula C10H11F3N4O and a molecular weight of 260.22 g/mol. Its IUPAC name is 1-diazenyl-1-methyl-3-[2-methyl-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-diazenyl-1-methyl-3-[2-methyl-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 163985169 |
| Molecular Formula | C10H11F3N4O |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 1-diazenyl-1-methyl-3-[2-methyl-3-(trifluoromethyl)phenyl]urea |
| SMILES | [H]/N=N/N(C)C(=O)Nc1cccc(C(F)(F)F)c1C |
| InChI | InChI=1S/C10H11F3N4O/c1-6-7(10(11,12)13)4-3-5-8(6)15-9(18)17(2)16-14/h3-5,14H,1-2H3,(H,15,18)/b16-14+ |
| InChIKey | TVQSDVTXXDOFIX-JQIJEIRASA-N |
| XLogP | 3.42 |
| TPSA | 68.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|