C12H14F3N3O — CID 66188265
1-(azetidin-3-yl)-1-methyl-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 66188265) has the molecular formula C12H14F3N3O and a molecular weight of 273.26 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-1-methyl-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(azetidin-3-yl)-1-methyl-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 66188265 |
| Molecular Formula | C12H14F3N3O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-(azetidin-3-yl)-1-methyl-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CN(C(=O)Nc1ccccc1C(F)(F)F)C1CNC1 |
| InChI | InChI=1S/C12H14F3N3O/c1-18(8-6-16-7-8)11(19)17-10-5-3-2-4-9(10)12(13,14)15/h2-5,8,16H,6-7H2,1H3,(H,17,19) |
| InChIKey | RNSBRASHXLKYLP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |