C15H18F4N2O — CID 69478072
1-cyclohexyl-3-[2-fluoro-3-(trifluoromethyl)phenyl]-1-methylurea (PubChem CID 69478072) has the molecular formula C15H18F4N2O and a molecular weight of 318.31 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-fluoro-3-(trifluoromethyl)phenyl]-1-methylurea.
| Compound Name | 1-cyclohexyl-3-[2-fluoro-3-(trifluoromethyl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 69478072 |
| Molecular Formula | C15H18F4N2O |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-cyclohexyl-3-[2-fluoro-3-(trifluoromethyl)phenyl]-1-methylurea |
| SMILES | CN(C(=O)Nc1cccc(C(F)(F)F)c1F)C1CCCCC1 |
| InChI | InChI=1S/C15H18F4N2O/c1-21(10-6-3-2-4-7-10)14(22)20-12-9-5-8-11(13(12)16)15(17,18)19/h5,8-10H,2-4,6-7H2,1H3,(H,20,22) |
| InChIKey | ZQUOFGSEJDAJEW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |