C12H11F4N3O — CID 3779878
1-(2-cyanoethyl)-3-[2-fluoro-3-(trifluoromethyl)phenyl]-1-methylurea (PubChem CID 3779878) has the molecular formula C12H11F4N3O and a molecular weight of 289.23 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-3-[2-fluoro-3-(trifluoromethyl)phenyl]-1-methylurea.
| Compound Name | 1-(2-cyanoethyl)-3-[2-fluoro-3-(trifluoromethyl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 3779878 |
| Molecular Formula | C12H11F4N3O |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 1-(2-cyanoethyl)-3-[2-fluoro-3-(trifluoromethyl)phenyl]-1-methylurea |
| SMILES | CN(CCC#N)C(=O)Nc1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C12H11F4N3O/c1-19(7-3-6-17)11(20)18-9-5-2-4-8(10(9)13)12(14,15)16/h2,4-5H,3,7H2,1H3,(H,18,20) |
| InChIKey | VRFCIIKOIRNNTM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |