C12H12F3N3OS — CID 3732092
1-(2-cyanoethyl)-1-methyl-3-[4-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 3732092) has the molecular formula C12H12F3N3OS and a molecular weight of 303.31 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-1-methyl-3-[4-(trifluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-(2-cyanoethyl)-1-methyl-3-[4-(trifluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 3732092 |
| Molecular Formula | C12H12F3N3OS |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-(2-cyanoethyl)-1-methyl-3-[4-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | CN(CCC#N)C(=O)Nc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12F3N3OS/c1-18(8-2-7-16)11(19)17-9-3-5-10(6-4-9)20-12(13,14)15/h3-6H,2,8H2,1H3,(H,17,19) |
| InChIKey | LPNRBSVCDYFUEG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |