C8H6F3NO2S — CID 146357026
[4-(trifluoromethylsulfanyl)phenyl]carbamic acid (PubChem CID 146357026) has the molecular formula C8H6F3NO2S and a molecular weight of 237.20 g/mol. Its IUPAC name is [4-(trifluoromethylsulfanyl)phenyl]carbamic acid.
| Compound Name | [4-(trifluoromethylsulfanyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 146357026 |
| Molecular Formula | C8H6F3NO2S |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | [4-(trifluoromethylsulfanyl)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C8H6F3NO2S/c9-8(10,11)15-6-3-1-5(2-4-6)12-7(13)14/h1-4,12H,(H,13,14) |
| InChIKey | UTHHMDCURQWTRY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |