C12H15F3N2OS — CID 79796566
2-amino-2-methyl-N-[4-(trifluoromethylsulfanyl)phenyl]butanamide (PubChem CID 79796566) has the molecular formula C12H15F3N2OS and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[4-(trifluoromethylsulfanyl)phenyl]butanamide.
| Compound Name | 2-amino-2-methyl-N-[4-(trifluoromethylsulfanyl)phenyl]butanamide |
|---|---|
| PubChem CID | 79796566 |
| Molecular Formula | C12H15F3N2OS |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-amino-2-methyl-N-[4-(trifluoromethylsulfanyl)phenyl]butanamide |
| SMILES | CCC(C)(N)C(=O)Nc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3N2OS/c1-3-11(2,16)10(18)17-8-4-6-9(7-5-8)19-12(13,14)15/h4-7H,3,16H2,1-2H3,(H,17,18) |
| InChIKey | WLWCQTRPBDAIMC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |