C12H13ClF3NOS — CID 63680173
3-chloro-2,2-dimethyl-N-[4-(trifluoromethylsulfanyl)phenyl]propanamide (PubChem CID 63680173) has the molecular formula C12H13ClF3NOS and a molecular weight of 311.76 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[4-(trifluoromethylsulfanyl)phenyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[4-(trifluoromethylsulfanyl)phenyl]propanamide |
|---|---|
| PubChem CID | 63680173 |
| Molecular Formula | C12H13ClF3NOS |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[4-(trifluoromethylsulfanyl)phenyl]propanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13ClF3NOS/c1-11(2,7-13)10(18)17-8-3-5-9(6-4-8)19-12(14,15)16/h3-6H,7H2,1-2H3,(H,17,18) |
| InChIKey | SMJKPLZCAPAAKZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|