C12H12F3N2O3S- — CID 86595327
2-methyl-2-[[4-(trifluoromethylsulfanyl)phenyl]carbamoylamino]propanoate (PubChem CID 86595327) has the molecular formula C12H12F3N2O3S- and a molecular weight of 321.30 g/mol. Its IUPAC name is 2-methyl-2-[[4-(trifluoromethylsulfanyl)phenyl]carbamoylamino]propanoate.
| Compound Name | 2-methyl-2-[[4-(trifluoromethylsulfanyl)phenyl]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 86595327 |
| Molecular Formula | C12H12F3N2O3S- |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-methyl-2-[[4-(trifluoromethylsulfanyl)phenyl]carbamoylamino]propanoate |
| SMILES | CC(C)(NC(=O)Nc1ccc(SC(F)(F)F)cc1)C(=O)[O-] |
| InChI | InChI=1S/C12H13F3N2O3S/c1-11(2,9(18)19)17-10(20)16-7-3-5-8(6-4-7)21-12(13,14)15/h3-6H,1-2H3,(H,18,19)(H2,16,17,20)/p-1 |
| InChIKey | JHRLKQDJJTZQOI-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |