C14H8F6N2OS — CID 71568663
1-[4-(trifluoromethylsulfanyl)phenyl]-3-(3,4,5-trifluorophenyl)urea (PubChem CID 71568663) has the molecular formula C14H8F6N2OS and a molecular weight of 366.29 g/mol. Its IUPAC name is 1-[4-(trifluoromethylsulfanyl)phenyl]-3-(3,4,5-trifluorophenyl)urea.
| Compound Name | 1-[4-(trifluoromethylsulfanyl)phenyl]-3-(3,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 71568663 |
| Molecular Formula | C14H8F6N2OS |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 1-[4-(trifluoromethylsulfanyl)phenyl]-3-(3,4,5-trifluorophenyl)urea |
| SMILES | O=C(Nc1ccc(SC(F)(F)F)cc1)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H8F6N2OS/c15-10-5-8(6-11(16)12(10)17)22-13(23)21-7-1-3-9(4-2-7)24-14(18,19)20/h1-6H,(H2,21,22,23) |
| InChIKey | OOZLGMJCUOMXGC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|