C14H8ClF4NO2S — CID 166523086
5-chloro-4-fluoro-2-hydroxy-N-[4-(trifluoromethylsulfanyl)phenyl]benzamide (PubChem CID 166523086) has the molecular formula C14H8ClF4NO2S and a molecular weight of 365.74 g/mol. Its IUPAC name is 5-chloro-4-fluoro-2-hydroxy-N-[4-(trifluoromethylsulfanyl)phenyl]benzamide.
| Compound Name | 5-chloro-4-fluoro-2-hydroxy-N-[4-(trifluoromethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 166523086 |
| Molecular Formula | C14H8ClF4NO2S |
| Molecular Weight | 365.74 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 5-chloro-4-fluoro-2-hydroxy-N-[4-(trifluoromethylsulfanyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(SC(F)(F)F)cc1)c1cc(Cl)c(F)cc1O |
| InChI | InChI=1S/C14H8ClF4NO2S/c15-10-5-9(12(21)6-11(10)16)13(22)20-7-1-3-8(4-2-7)23-14(17,18)19/h1-6,21H,(H,20,22) |
| InChIKey | ULOMMGVKVFFVEP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.74 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |