C18H10B2F3NO2S — CID 89279152
CID 89279152 (PubChem CID 89279152) has the molecular formula C18H10B2F3NO2S and a molecular weight of 382.97 g/mol.
| Compound Name | CID 89279152 |
|---|---|
| PubChem CID | 89279152 |
| Molecular Formula | C18H10B2F3NO2S |
| Molecular Weight | 382.97 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c([B])c(O)c(C(=O)Nc3ccc(SC(F)(F)F)cc3)cc2c1 |
| InChI | InChI=1S/C18H10B2F3NO2S/c19-10-1-6-13-9(7-10)8-14(16(25)15(13)20)17(26)24-11-2-4-12(5-3-11)27-18(21,22)23/h1-8,25H,(H,24,26) |
| InChIKey | KYEQGEYVFDFMCQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.97 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|