C12H11F3N2OS — CID 79286741
2-(prop-2-ynylamino)-N-[4-(trifluoromethylsulfanyl)phenyl]acetamide (PubChem CID 79286741) has the molecular formula C12H11F3N2OS and a molecular weight of 288.29 g/mol. Its IUPAC name is 2-(prop-2-ynylamino)-N-[4-(trifluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-(prop-2-ynylamino)-N-[4-(trifluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 79286741 |
| Molecular Formula | C12H11F3N2OS |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-(prop-2-ynylamino)-N-[4-(trifluoromethylsulfanyl)phenyl]acetamide |
| SMILES | C#CCNCC(=O)Nc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F3N2OS/c1-2-7-16-8-11(18)17-9-3-5-10(6-4-9)19-12(13,14)15/h1,3-6,16H,7-8H2,(H,17,18) |
| InChIKey | QARNUTQYMARJEU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|