C22H23ClN6O2 — CID 147688565
3-[3-chloro-2-[[4-(4-ethylpyrimidin-2-yl)-2-methylphenoxy]methyl]phenyl]-1-diazenyl-1-methylurea (PubChem CID 147688565) has the molecular formula C22H23ClN6O2 and a molecular weight of 438.92 g/mol. Its IUPAC name is 3-[3-chloro-2-[[4-(4-ethylpyrimidin-2-yl)-2-methylphenoxy]methyl]phenyl]-1-diazenyl-1-methylurea.
| Compound Name | 3-[3-chloro-2-[[4-(4-ethylpyrimidin-2-yl)-2-methylphenoxy]methyl]phenyl]-1-diazenyl-1-methylurea |
|---|---|
| PubChem CID | 147688565 |
| Molecular Formula | C22H23ClN6O2 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 3-[3-chloro-2-[[4-(4-ethylpyrimidin-2-yl)-2-methylphenoxy]methyl]phenyl]-1-diazenyl-1-methylurea |
| SMILES | [H]/N=N/N(C)C(=O)Nc1cccc(Cl)c1COc1ccc(-c2nccc(CC)n2)cc1C |
| InChI | InChI=1S/C22H23ClN6O2/c1-4-16-10-11-25-21(26-16)15-8-9-20(14(2)12-15)31-13-17-18(23)6-5-7-19(17)27-22(30)29(3)28-24/h5-12,24H,4,13H2,1-3H3,(H,27,30)/b28-24+ |
| InChIKey | GQMYCOBQMHJWKZ-ZZIIXHQDSA-N |
| XLogP | 5.66 |
| TPSA | 103.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|