C19H21N7O2 — CID 162095536
1-diazenyl-1-methyl-3-[3-methyl-2-[[2-methyl-4-(triazol-2-yl)phenoxy]methyl]phenyl]urea (PubChem CID 162095536) has the molecular formula C19H21N7O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-diazenyl-1-methyl-3-[3-methyl-2-[[2-methyl-4-(triazol-2-yl)phenoxy]methyl]phenyl]urea.
| Compound Name | 1-diazenyl-1-methyl-3-[3-methyl-2-[[2-methyl-4-(triazol-2-yl)phenoxy]methyl]phenyl]urea |
|---|---|
| PubChem CID | 162095536 |
| Molecular Formula | C19H21N7O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 1-diazenyl-1-methyl-3-[3-methyl-2-[[2-methyl-4-(triazol-2-yl)phenoxy]methyl]phenyl]urea |
| SMILES | [H]/N=N/N(C)C(=O)Nc1cccc(C)c1COc1ccc(-n2nccn2)cc1C |
| InChI | InChI=1S/C19H21N7O2/c1-13-5-4-6-17(23-19(27)25(3)24-20)16(13)12-28-18-8-7-15(11-14(18)2)26-21-9-10-22-26/h4-11,20H,12H2,1-3H3,(H,23,27)/b24-20+ |
| InChIKey | ZEEWFSYYZIFRHI-HIXSDJFHSA-N |
| XLogP | 3.87 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|