C16H20N6O2 — CID 137250692
3-[5-cyclopropyl-4-[(2-methylphenoxy)methyl]-1H-pyrazol-3-yl]-1-diazenyl-1-methylurea (PubChem CID 137250692) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 3-[5-cyclopropyl-4-[(2-methylphenoxy)methyl]-1H-pyrazol-3-yl]-1-diazenyl-1-methylurea.
| Compound Name | 3-[5-cyclopropyl-4-[(2-methylphenoxy)methyl]-1H-pyrazol-3-yl]-1-diazenyl-1-methylurea |
|---|---|
| PubChem CID | 137250692 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 3-[5-cyclopropyl-4-[(2-methylphenoxy)methyl]-1H-pyrazol-3-yl]-1-diazenyl-1-methylurea |
| SMILES | [H]/N=N/N(C)C(=O)Nc1n[nH]c(C2CC2)c1COc1ccccc1C |
| InChI | InChI=1S/C16H20N6O2/c1-10-5-3-4-6-13(10)24-9-12-14(11-7-8-11)19-20-15(12)18-16(23)22(2)21-17/h3-6,11,17H,7-9H2,1-2H3,(H2,18,19,20,23)/b21-17+ |
| InChIKey | BZEYSDVEFJUHIX-HEHNFIMWSA-N |
| XLogP | 3.58 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|