C13H13BrN4O3 — CID 137250725
1-[5-bromo-4-[(2-methylphenoxy)methyl]furan-3-yl]-3-diazenylurea (PubChem CID 137250725) has the molecular formula C13H13BrN4O3 and a molecular weight of 353.18 g/mol. Its IUPAC name is 1-[5-bromo-4-[(2-methylphenoxy)methyl]furan-3-yl]-3-diazenylurea.
| Compound Name | 1-[5-bromo-4-[(2-methylphenoxy)methyl]furan-3-yl]-3-diazenylurea |
|---|---|
| PubChem CID | 137250725 |
| Molecular Formula | C13H13BrN4O3 |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 1-[5-bromo-4-[(2-methylphenoxy)methyl]furan-3-yl]-3-diazenylurea |
| SMILES | [H]/N=N/NC(=O)Nc1coc(Br)c1COc1ccccc1C |
| InChI | InChI=1S/C13H13BrN4O3/c1-8-4-2-3-5-11(8)20-6-9-10(7-21-12(9)14)16-13(19)17-18-15/h2-5,7H,6H2,1H3,(H3,15,16,17,19) |
| InChIKey | VHFXPYMSDJFMDQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|