C22H26N2O4 — CID 173323715
[2-[[1-(2,3-dihydro-1H-inden-5-yl)ethylideneamino]oxymethyl]-3-methylphenyl]-(methoxymethyl)carbamic acid (PubChem CID 173323715) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-[[1-(2,3-dihydro-1H-inden-5-yl)ethylideneamino]oxymethyl]-3-methylphenyl]-(methoxymethyl)carbamic acid.
| Compound Name | [2-[[1-(2,3-dihydro-1H-inden-5-yl)ethylideneamino]oxymethyl]-3-methylphenyl]-(methoxymethyl)carbamic acid |
|---|---|
| PubChem CID | 173323715 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [2-[[1-(2,3-dihydro-1H-inden-5-yl)ethylideneamino]oxymethyl]-3-methylphenyl]-(methoxymethyl)carbamic acid |
| SMILES | COCN(C(=O)O)c1cccc(C)c1CON=C(C)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H26N2O4/c1-15-6-4-9-21(24(14-27-3)22(25)26)20(15)13-28-23-16(2)18-11-10-17-7-5-8-19(17)12-18/h4,6,9-12H,5,7-8,13-14H2,1-3H3,(H,25,26) |
| InChIKey | XKNXXOLBWYUMTB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|