C22H31NO5 — CID 87571296
2-methyl-5-[4-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid (PubChem CID 87571296) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is 2-methyl-5-[4-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid.
| Compound Name | 2-methyl-5-[4-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 87571296 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 2-methyl-5-[4-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid |
| SMILES | CC(=NOCCCCC1COC(C)(C(=O)O)OC1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H31NO5/c1-16(19-11-10-18-8-3-4-9-20(18)13-19)23-28-12-6-5-7-17-14-26-22(2,21(24)25)27-15-17/h10-11,13,17H,3-9,12,14-15H2,1-2H3,(H,24,25) |
| InChIKey | RIOISYVPHJWVFI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|