C19H27NO8S — CID 24763142
2-methyl-5-[4-[(Z)-1-(4-methylsulfonyloxyphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid (PubChem CID 24763142) has the molecular formula C19H27NO8S and a molecular weight of 429.49 g/mol. Its IUPAC name is 2-methyl-5-[4-[(Z)-1-(4-methylsulfonyloxyphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid.
| Compound Name | 2-methyl-5-[4-[(Z)-1-(4-methylsulfonyloxyphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 24763142 |
| Molecular Formula | C19H27NO8S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 2-methyl-5-[4-[(Z)-1-(4-methylsulfonyloxyphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid |
| SMILES | C/C(=N/OCCCCC1COC(C)(C(=O)O)OC1)c1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H27NO8S/c1-14(16-7-9-17(10-8-16)28-29(3,23)24)20-27-11-5-4-6-15-12-25-19(2,18(21)22)26-13-15/h7-10,15H,4-6,11-13H2,1-3H3,(H,21,22)/b20-14- |
| InChIKey | XHUPLCPCPRKIAD-ZHZULCJRSA-N |
| XLogP | 2.40 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|