C21H31NO7 — CID 86648422
methyl 5-[4-[1-[4-(methoxymethoxy)phenyl]ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate (PubChem CID 86648422) has the molecular formula C21H31NO7 and a molecular weight of 409.48 g/mol. Its IUPAC name is methyl 5-[4-[1-[4-(methoxymethoxy)phenyl]ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate.
| Compound Name | methyl 5-[4-[1-[4-(methoxymethoxy)phenyl]ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 86648422 |
| Molecular Formula | C21H31NO7 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | methyl 5-[4-[1-[4-(methoxymethoxy)phenyl]ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate |
| SMILES | COCOc1ccc(C(C)=NOCCCCC2COC(C)(C(=O)OC)OC2)cc1 |
| InChI | InChI=1S/C21H31NO7/c1-16(18-8-10-19(11-9-18)26-15-24-3)22-29-12-6-5-7-17-13-27-21(2,28-14-17)20(23)25-4/h8-11,17H,5-7,12-15H2,1-4H3 |
| InChIKey | QQNNZNAGRJUAKR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|