C12H22O5 — CID 155658217
methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate (PubChem CID 155658217) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate.
| Compound Name | methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 155658217 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate |
| SMILES | COC(=O)C1(C)OCC(CCCCCO)CO1 |
| InChI | InChI=1S/C12H22O5/c1-12(11(14)15-2)16-8-10(9-17-12)6-4-3-5-7-13/h10,13H,3-9H2,1-2H3 |
| InChIKey | RFWYQFPMZGDPCW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|