About methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate
methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate (PubChem CID 155658217) has the molecular formula C12H22O5
and a molecular weight of 246.30 g/mol. Its IUPAC name is methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate |
| PubChem CID | 155658217 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate |
| SMILES | COC(=O)C1(C)OCC(CCCCCO)CO1 |
| InChI | InChI=1S/C12H22O5/c1-12(11(14)15-2)16-8-10(9-17-12)6-4-3-5-7-13/h10,13H,3-9H2,1-2H3 |
| InChIKey | RFWYQFPMZGDPCW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate?
The IUPAC name of methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate (CID 155658217) is methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate.
What is the SMILES notation for methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate?
The canonical SMILES for methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate is COC(=O)C1(C)OCC(CCCCCO)CO1.
What is the InChIKey of methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate?
The InChIKey is RFWYQFPMZGDPCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O5/c1-12(11(14)15-2)16-8-10(9-17-12)6-4-3-5-7-13/h10,13H,3-9H2,1-2H3.
What are the key properties of methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate?
methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate has a molecular weight of 246.30 g/mol, XLogP of 1.09, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(5-hydroxypentyl)-2-methyl-1,3-dioxane-2-carboxylate is sourced from PubChem (CID 155658217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).