About 5-(4-hydroxybutyl)-1,3-dioxan-2-one
5-(4-hydroxybutyl)-1,3-dioxan-2-one (PubChem CID 102293828) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is 5-(4-hydroxybutyl)-1,3-dioxan-2-one.
Molecular Properties
| Compound Name | 5-(4-hydroxybutyl)-1,3-dioxan-2-one |
| PubChem CID | 102293828 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 5-(4-hydroxybutyl)-1,3-dioxan-2-one |
| SMILES | O=C1OCC(CCCCO)CO1 |
| InChI | InChI=1S/C8H14O4/c9-4-2-1-3-7-5-11-8(10)12-6-7/h7,9H,1-6H2 |
| InChIKey | PSFNRCYKZQGBHE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-hydroxybutyl)-1,3-dioxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-hydroxybutyl)-1,3-dioxan-2-one?
The IUPAC name of 5-(4-hydroxybutyl)-1,3-dioxan-2-one (CID 102293828) is 5-(4-hydroxybutyl)-1,3-dioxan-2-one.
What is the SMILES notation for 5-(4-hydroxybutyl)-1,3-dioxan-2-one?
The canonical SMILES for 5-(4-hydroxybutyl)-1,3-dioxan-2-one is O=C1OCC(CCCCO)CO1.
What is the InChIKey of 5-(4-hydroxybutyl)-1,3-dioxan-2-one?
The InChIKey is PSFNRCYKZQGBHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c9-4-2-1-3-7-5-11-8(10)12-6-7/h7,9H,1-6H2.
What are the key properties of 5-(4-hydroxybutyl)-1,3-dioxan-2-one?
5-(4-hydroxybutyl)-1,3-dioxan-2-one has a molecular weight of 174.20 g/mol, XLogP of 0.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-hydroxybutyl)-1,3-dioxan-2-one is sourced from PubChem (CID 102293828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).