C23H35NO5 — CID 91452638
methyl 5-[4-[1-(4-butylphenyl)ethenylamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate (PubChem CID 91452638) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is methyl 5-[4-[1-(4-butylphenyl)ethenylamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate.
| Compound Name | methyl 5-[4-[1-(4-butylphenyl)ethenylamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 91452638 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | methyl 5-[4-[1-(4-butylphenyl)ethenylamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate |
| SMILES | C=C(NOCCCCC1COC(C)(C(=O)OC)OC1)c1ccc(CCCC)cc1 |
| InChI | InChI=1S/C23H35NO5/c1-5-6-9-19-11-13-21(14-12-19)18(2)24-29-15-8-7-10-20-16-27-23(3,28-17-20)22(25)26-4/h11-14,20,24H,2,5-10,15-17H2,1,3-4H3 |
| InChIKey | SSLMHOLMJWDZFN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|