C18H26N2O5 — CID 90708214
methyl 2-methyl-5-[4-(1-pyridin-3-ylethenylamino)oxybutyl]-1,3-dioxane-2-carboxylate (PubChem CID 90708214) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is methyl 2-methyl-5-[4-(1-pyridin-3-ylethenylamino)oxybutyl]-1,3-dioxane-2-carboxylate.
| Compound Name | methyl 2-methyl-5-[4-(1-pyridin-3-ylethenylamino)oxybutyl]-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 90708214 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | methyl 2-methyl-5-[4-(1-pyridin-3-ylethenylamino)oxybutyl]-1,3-dioxane-2-carboxylate |
| SMILES | C=C(NOCCCCC1COC(C)(C(=O)OC)OC1)c1cccnc1 |
| InChI | InChI=1S/C18H26N2O5/c1-14(16-8-6-9-19-11-16)20-25-10-5-4-7-15-12-23-18(2,24-13-15)17(21)22-3/h6,8-9,11,15,20H,1,4-5,7,10,12-13H2,2-3H3 |
| InChIKey | GDWUACGHXPZETB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|