C21H31NO6 — CID 87570692
methyl 5-[4-[1-(4-methoxyphenyl)propylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate (PubChem CID 87570692) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is methyl 5-[4-[1-(4-methoxyphenyl)propylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate.
| Compound Name | methyl 5-[4-[1-(4-methoxyphenyl)propylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 87570692 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | methyl 5-[4-[1-(4-methoxyphenyl)propylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate |
| SMILES | CCC(=NOCCCCC1COC(C)(C(=O)OC)OC1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H31NO6/c1-5-19(17-9-11-18(24-3)12-10-17)22-28-13-7-6-8-16-14-26-21(2,27-15-16)20(23)25-4/h9-12,16H,5-8,13-15H2,1-4H3 |
| InChIKey | SLSJBMSABLQUQD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|