C22H26F3N3O3 — CID 135190265
N-[2-[[1-[4-methoxy-3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]-3-methylphenyl]butanehydrazide (PubChem CID 135190265) has the molecular formula C22H26F3N3O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is N-[2-[[1-[4-methoxy-3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]-3-methylphenyl]butanehydrazide.
| Compound Name | N-[2-[[1-[4-methoxy-3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]-3-methylphenyl]butanehydrazide |
|---|---|
| PubChem CID | 135190265 |
| Molecular Formula | C22H26F3N3O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-[2-[[1-[4-methoxy-3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]-3-methylphenyl]butanehydrazide |
| SMILES | CCCC(=O)N(N)c1cccc(C)c1CON=C(C)c1ccc(OC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H26F3N3O3/c1-5-7-21(29)28(26)19-9-6-8-14(2)17(19)13-31-27-15(3)16-10-11-20(30-4)18(12-16)22(23,24)25/h6,8-12H,5,7,13,26H2,1-4H3 |
| InChIKey | CLBBBOMZPAULPN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|