C10H9ClF3N3O2 — CID 67582144
N-(N'-chlorocarbamimidoyl)-4-methoxy-3-(trifluoromethyl)benzamide (PubChem CID 67582144) has the molecular formula C10H9ClF3N3O2 and a molecular weight of 295.65 g/mol. Its IUPAC name is N-(N'-chlorocarbamimidoyl)-4-methoxy-3-(trifluoromethyl)benzamide.
| Compound Name | N-(N'-chlorocarbamimidoyl)-4-methoxy-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 67582144 |
| Molecular Formula | C10H9ClF3N3O2 |
| Molecular Weight | 295.65 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | N-(N'-chlorocarbamimidoyl)-4-methoxy-3-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(C(=O)NC(N)=NCl)cc1C(F)(F)F |
| InChI | InChI=1S/C10H9ClF3N3O2/c1-19-7-3-2-5(4-6(7)10(12,13)14)8(18)16-9(15)17-11/h2-4H,1H3,(H3,15,16,17,18) |
| InChIKey | OTJYBFWRFWWXMS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.65 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|