C11H13ClF3N3O3 — CID 22435440
[4-methoxy-3-(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamate;hydrochloride (PubChem CID 22435440) has the molecular formula C11H13ClF3N3O3 and a molecular weight of 327.69 g/mol. Its IUPAC name is [4-methoxy-3-(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamate;hydrochloride.
| Compound Name | [4-methoxy-3-(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamate;hydrochloride |
|---|---|
| PubChem CID | 22435440 |
| Molecular Formula | C11H13ClF3N3O3 |
| Molecular Weight | 327.69 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | [4-methoxy-3-(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamate;hydrochloride |
| SMILES | COc1ccc(COC(=O)N=C(N)N)cc1C(F)(F)F.Cl |
| InChI | InChI=1S/C11H12F3N3O3.ClH/c1-19-8-3-2-6(4-7(8)11(12,13)14)5-20-10(18)17-9(15)16;/h2-4H,5H2,1H3,(H4,15,16,17,18);1H |
| InChIKey | RMKIADKIUILBFL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.69 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|