C13H16F3NO3 — CID 63949541
methyl 3-[4-(2-aminoethyl)-2-(trifluoromethyl)phenoxy]propanoate (PubChem CID 63949541) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is methyl 3-[4-(2-aminoethyl)-2-(trifluoromethyl)phenoxy]propanoate.
| Compound Name | methyl 3-[4-(2-aminoethyl)-2-(trifluoromethyl)phenoxy]propanoate |
|---|---|
| PubChem CID | 63949541 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | methyl 3-[4-(2-aminoethyl)-2-(trifluoromethyl)phenoxy]propanoate |
| SMILES | COC(=O)CCOc1ccc(CCN)cc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO3/c1-19-12(18)5-7-20-11-3-2-9(4-6-17)8-10(11)13(14,15)16/h2-3,8H,4-7,17H2,1H3 |
| InChIKey | XNOKGCOFPPGDSA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |