C20H22F3NO4 — CID 126587845
methyl N-[2-[[4-ethyl-5-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl]-N-hydroxycarbamate (PubChem CID 126587845) has the molecular formula C20H22F3NO4 and a molecular weight of 397.39 g/mol. Its IUPAC name is methyl N-[2-[[4-ethyl-5-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl]-N-hydroxycarbamate.
| Compound Name | methyl N-[2-[[4-ethyl-5-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 126587845 |
| Molecular Formula | C20H22F3NO4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | methyl N-[2-[[4-ethyl-5-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl]-N-hydroxycarbamate |
| SMILES | CCc1cc(C(F)(F)F)c(OCc2c(C)cccc2N(O)C(=O)OC)cc1C |
| InChI | InChI=1S/C20H22F3NO4/c1-5-14-10-16(20(21,22)23)18(9-13(14)3)28-11-15-12(2)7-6-8-17(15)24(26)19(25)27-4/h6-10,26H,5,11H2,1-4H3 |
| InChIKey | XGKOCNWGWFICBA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|