C19H22ClNO4 — CID 126587825
methyl N-[2-[(2-chloro-4-ethyl-5-methylphenoxy)methyl]-3-methylphenyl]-N-hydroxycarbamate (PubChem CID 126587825) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is methyl N-[2-[(2-chloro-4-ethyl-5-methylphenoxy)methyl]-3-methylphenyl]-N-hydroxycarbamate.
| Compound Name | methyl N-[2-[(2-chloro-4-ethyl-5-methylphenoxy)methyl]-3-methylphenyl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 126587825 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | methyl N-[2-[(2-chloro-4-ethyl-5-methylphenoxy)methyl]-3-methylphenyl]-N-hydroxycarbamate |
| SMILES | CCc1cc(Cl)c(OCc2c(C)cccc2N(O)C(=O)OC)cc1C |
| InChI | InChI=1S/C19H22ClNO4/c1-5-14-10-16(20)18(9-13(14)3)25-11-15-12(2)7-6-8-17(15)21(23)19(22)24-4/h6-10,23H,5,11H2,1-4H3 |
| InChIKey | UQRHUZGCSSIUMK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|