C19H20BrF2NO4 — CID 126588187
methyl N-[3-bromo-2-[[2-(difluoromethyl)-4-ethyl-5-methylphenoxy]methyl]phenyl]-N-hydroxycarbamate (PubChem CID 126588187) has the molecular formula C19H20BrF2NO4 and a molecular weight of 444.27 g/mol. Its IUPAC name is methyl N-[3-bromo-2-[[2-(difluoromethyl)-4-ethyl-5-methylphenoxy]methyl]phenyl]-N-hydroxycarbamate.
| Compound Name | methyl N-[3-bromo-2-[[2-(difluoromethyl)-4-ethyl-5-methylphenoxy]methyl]phenyl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 126588187 |
| Molecular Formula | C19H20BrF2NO4 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | methyl N-[3-bromo-2-[[2-(difluoromethyl)-4-ethyl-5-methylphenoxy]methyl]phenyl]-N-hydroxycarbamate |
| SMILES | CCc1cc(C(F)F)c(OCc2c(Br)cccc2N(O)C(=O)OC)cc1C |
| InChI | InChI=1S/C19H20BrF2NO4/c1-4-12-9-13(18(21)22)17(8-11(12)2)27-10-14-15(20)6-5-7-16(14)23(25)19(24)26-3/h5-9,18,25H,4,10H2,1-3H3 |
| InChIKey | JPXFGXLWMOQSPR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|