C19H17F6NO4 — CID 126587815
methyl N-[2-[[4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-(trifluoromethyl)phenyl]-N-hydroxycarbamate (PubChem CID 126587815) has the molecular formula C19H17F6NO4 and a molecular weight of 437.34 g/mol. Its IUPAC name is methyl N-[2-[[4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-(trifluoromethyl)phenyl]-N-hydroxycarbamate.
| Compound Name | methyl N-[2-[[4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-(trifluoromethyl)phenyl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 126587815 |
| Molecular Formula | C19H17F6NO4 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | methyl N-[2-[[4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-(trifluoromethyl)phenyl]-N-hydroxycarbamate |
| SMILES | CCc1ccc(OCc2c(N(O)C(=O)OC)cccc2C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F6NO4/c1-3-11-7-8-16(14(9-11)19(23,24)25)30-10-12-13(18(20,21)22)5-4-6-15(12)26(28)17(27)29-2/h4-9,28H,3,10H2,1-2H3 |
| InChIKey | PCBWXZQZWBBIEV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|