C19H19F3INO2 — CID 126588283
2-[2-[[4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-iodophenyl]-N-methylacetamide (PubChem CID 126588283) has the molecular formula C19H19F3INO2 and a molecular weight of 477.26 g/mol. Its IUPAC name is 2-[2-[[4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-iodophenyl]-N-methylacetamide.
| Compound Name | 2-[2-[[4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-iodophenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 126588283 |
| Molecular Formula | C19H19F3INO2 |
| Molecular Weight | 477.26 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 2-[2-[[4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-iodophenyl]-N-methylacetamide |
| SMILES | CCc1ccc(OCc2c(I)cccc2CC(=O)NC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F3INO2/c1-3-12-7-8-17(15(9-12)19(20,21)22)26-11-14-13(10-18(25)24-2)5-4-6-16(14)23/h4-9H,3,10-11H2,1-2H3,(H,24,25) |
| InChIKey | ZMDZEHDGSIQGHQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.26 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|